| id | C00008870 |
|---|---|
| Name | Epicatechin 3-O-(4-O-methylgallate) |
| CAS RN | 108907-44-4 |
| Standard InChI | InChI=1S/C23H20O10/c1-31-22-17(28)5-11(6-18(22)29)23(30)33-20-9-13-15(26)7-12(24)8-19(13)32-21(20)10-2-3-14(25)16(27)4-10/h2-8,20-21,24-29H,9H2,1H3/t20-,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H20O10/c1-31-22-17(28)5-11(6-18(22)29)23(30)33-20-9-13-15(26)7-12(24)8-19(13)32-21(20)10-2-3-14(25)16(27)4-10/h2-8,20-21,24-29H,9H2,1H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 219 |
| By standard InChI | CHEMBL159433 |
|---|---|
| By standard InChI Main Layer | CHEMBL159433 CHEMBL556692 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Camellia sinensis var. assamica | 261999 | Theaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P50281 | Matrix metalloproteinase-14 | M10A | CHEMBL159433 CHEMBL556692 |
CHEMBL1064084
(2)
|
0 / 0 |
| P09237 | Matrilysin | M10A | CHEMBL159433 CHEMBL556692 |
CHEMBL1064085
(2)
|
0 / 0 |
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL159433 CHEMBL556692 |
CHEMBL1064086
(2)
|
1 / 3 |