| id | C00009321 |
|---|---|
| Name | Prodelphinidin B6 |
| CAS RN | 61541-02-4 |
| Standard InChI | InChI=1S/C21H18O9/c22-9-4-13(26)17(14(27)5-9)19-18-15(28)6-10(23)7-16(18)30-21(20(19)29)8-1-2-11(24)12(25)3-8/h1-7,19-29H/t19-,20+,21+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H18O9/c22-9-4-13(26)17(14(27)5-9)19-18-15(28)6-10(23)7-16(18)30-21(20(19)29)8-1-2-11(24)12(25)3-8/h1-7,19-29H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 444 |
| By standard InChI | CHEMBL1223837 |
|---|---|
| By standard InChI Main Layer | CHEMBL1223837 CHEMBL1223839 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Aizoaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Nelia meyeri | 3542 | Aizoaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07998 | Ribonuclease pancreatic | Enzyme | CHEMBL1223837 CHEMBL1223839 |
CHEMBL1225512
(2)
CHEMBL1225513
(2)
|
0 / 0 |