| id | C00009379 |
|---|---|
| Name | 7-Hydroxy-2-methylisoflavone |
| CAS RN | 2859-88-3 |
| Standard InChI | InChI=1S/C16H12O3/c1-10-15(11-5-3-2-4-6-11)16(18)13-8-7-12(17)9-14(13)19-10/h2-9,17H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O3/c1-10-15(11-5-3-2-4-6-11)16(18)13-8-7-12(17)9-14(13)19-10/h2-9,17H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1585 |
| By standard InChI | CHEMBL489340 |
|---|---|
| By standard InChI Main Layer | CHEMBL489340 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycyrrhiza glabra | 49827 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL489340 |
CHEMBL1614458
(1)
|
0 / 0 |
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL489340 |
CHEMBL1794495
(1)
|
2 / 2 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL489340 |
CHEMBL1613914
(1)
|
0 / 0 |