| id | C00009439 |
|---|---|
| Name | Maximaisoflavone B |
| CAS RN | 4737-28-4 |
| Standard InChI | InChI=1S/C21H18O5/c1-13(2)7-8-23-15-4-5-16-19(10-15)24-11-17(21(16)22)14-3-6-18-20(9-14)26-12-25-18/h3-7,9-11H,8,12H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H18O5/c1-13(2)7-8-23-15-4-5-16-19(10-15)24-11-17(21(16)22)14-3-6-18-20(9-14)26-12-25-18/h3-7,9-11H,8,12H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 354 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tephrosia maxima | 3803 | Fabaceae | rosids | Viridiplantae |