| id | C00009609 |
|---|---|
| Name | Villinol |
| CAS RN | 65160-17-0 |
| Standard InChI | InChI=1S/C24H22O8/c1-10(2)14-7-12-15(30-14)8-13(25)20-21(26)19-11-6-17(27-3)18(28-4)9-16(11)31-24(29-5)23(19)32-22(12)20/h6,8-9,14,24-25H,1,7H2,2-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C24H22O8/c1-10(2)14-7-12-15(30-14)8-13(25)20-21(26)19-11-6-17(27-3)18(28-4)9-16(11)31-24(29-5)23(19)32-22(12)20/h6,8-9,14,24-25H,1,7H2,2-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 236 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tephrosia villosa | 62125 | Fabaceae | rosids | Viridiplantae |