| id | C00009817 |
|---|---|
| Name | 5,3'-Dihydroxy-7,4'-dimethoxyisoflavone |
| CAS RN | 83459-56-7 |
| Standard InChI | InChI=1S/C17H14O6/c1-21-10-6-13(19)16-15(7-10)23-8-11(17(16)20)9-3-4-14(22-2)12(18)5-9/h3-8,18-19H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-21-10-6-13(19)16-15(7-10)23-8-11(17(16)20)9-3-4-14(22-2)12(18)5-9/h3-8,18-19H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Simsia foetida | 684003 | Asteraceae | asterids | Viridiplantae |