| id | C00009984 |
|---|---|
| Name | Boeravinone C / 4,11,12a-Trihydroxy-9-methoxy-10-methylrotenone |
| CAS RN | 117176-19-9 |
| Standard InChI | InChI=1S/C18H16O7/c1-8-11(23-2)6-12-14(15(8)20)17(21)18(22)9-4-3-5-10(19)16(9)24-7-13(18)25-12/h3-6,13,19-20,22H,7H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O7/c1-8-11(23-2)6-12-14(15(8)20)17(21)18(22)9-4-3-5-10(19)16(9)24-7-13(18)25-12/h3-6,13,19-20,22H,7H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 968 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL426722 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Nyctaginaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Boerhavia diffusa | 930814 | Nyctaginaceae | eudicotyledons | Viridiplantae |
| Mirabilis jalapa | 3538 | Nyctaginaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL426722 |
CHEMBL919516
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|