| id | C00010042 | 
|---|---|
| Name | Licopyranocoumarin | 
| CAS RN | 117038-80-9 | 
| Standard InChI | InChI=1S/C21H20O7/c1-21(10-22)6-5-13-18(28-21)9-17-15(19(13)26-2)8-14(20(25)27-17)12-4-3-11(23)7-16(12)24/h3-4,7-9,22-24H,5-6,10H2,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C21H20O7/c1-21(10-22)6-5-13-18(28-21)9-17-15(19(13)26-2)8-14(20(25)27-17)12-4-3-11(23)7-16(12)24/h3-4,7-9,22-24H,5-6,10H2,1-2H3 | 
| Phytochemical cluster | No. 17 | 
|---|---|
| KCF-S cluster | No. 582 | 
| By standard InChI | CHEMBL597425 | 
|---|---|
| By standard InChI Main Layer | CHEMBL597425 | 
| By LinkDB | 
|---|
| By CAS RN | C063348 | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Glycyrrhiza glabra | 49827 | Fabaceae | rosids | Viridiplantae | 
| Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C063348 | 1543 | CYP1A1 AHH AHRR CP11 CYP1 P1-450 P450-C P450DX | cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | licopyranocoumarin inhibits the reaction [Tetrachlorodibenzodioxin results in increased expression of CYP1A1 mRNA] | decreases reaction / increases expression | mRNA | 18451504 |