id | C00010042 |
---|---|
Name | Licopyranocoumarin |
CAS RN | 117038-80-9 |
Standard InChI | InChI=1S/C21H20O7/c1-21(10-22)6-5-13-18(28-21)9-17-15(19(13)26-2)8-14(20(25)27-17)12-4-3-11(23)7-16(12)24/h3-4,7-9,22-24H,5-6,10H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C21H20O7/c1-21(10-22)6-5-13-18(28-21)9-17-15(19(13)26-2)8-14(20(25)27-17)12-4-3-11(23)7-16(12)24/h3-4,7-9,22-24H,5-6,10H2,1-2H3 |
Phytochemical cluster | No. 17 |
---|---|
KCF-S cluster | No. 582 |
By standard InChI | CHEMBL597425 |
---|---|
By standard InChI Main Layer | CHEMBL597425 |
By LinkDB |
---|
By CAS RN | C063348 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Glycyrrhiza glabra | 49827 | Fabaceae | rosids | Viridiplantae |
Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
---|---|---|---|---|---|---|---|
C063348 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | licopyranocoumarin inhibits the reaction [Tetrachlorodibenzodioxin results in increased expression of CYP1A1 mRNA] |
decreases reaction
/ increases expression |
mRNA |
18451504
|