| id | C00010089 |
|---|---|
| Name | Glycitin / Glycitein 7-O-glucoside |
| CAS RN | 40246-10-4 |
| Standard InChI | InChI=1S/C22H22O10/c1-29-15-6-12-14(30-9-13(18(12)25)10-2-4-11(24)5-3-10)7-16(15)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17?,19-,20+,21?,22-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H22O10/c1-29-15-6-12-14(30-9-13(18(12)25)10-2-4-11(24)5-3-10)7-16(15)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1574061 |
| By LinkDB | C16195 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycine max | 3847 | Fabaceae | rosids | Viridiplantae |
| Pueraria thunbergiana | 3892 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL1574061 |
CHEMBL1613842
(1)
|
4 / 2 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1574061 |
CHEMBL1614458
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1574061 |
CHEMBL1738588
(1)
|
0 / 0 |