| id | C00010253 | 
|---|---|
| Name | (S)-4'-Hydroxy-4-methoxydalbergione | 
| CAS RN | 3755-63-3 | 
| Standard InChI | InChI=1S/C16H14O4/c1-3-12(10-4-6-11(17)7-5-10)13-8-15(19)16(20-2)9-14(13)18/h3-9,12,17H,1H2,2H3/t12-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-3-12(10-4-6-11(17)7-5-10)13-8-15(19)16(20-2)9-14(13)18/h3-9,12,17H,1H2,2H3 | 
| Phytochemical cluster | No. 18 | 
|---|---|
| KCF-S cluster | No. 1327 | 
| By standard InChI | CHEMBL255296 | 
|---|---|
| By standard InChI Main Layer | CHEMBL255296 CHEMBL1374504 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dalbergia spp. | 53862 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL1374504 | CHEMBL1613800
                        (1) | 0 / 0 | 
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL1374504 | CHEMBL1794467
                        (1) | 0 / 0 | 
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL1374504 | CHEMBL1614240
                        (1) | 0 / 0 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1374504 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1374504 | CHEMBL1614250
                        (1)
                        CHEMBL1614421
                        (1) CHEMBL1614502 (1) | 4 / 3 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1374504 | CHEMBL1613914
                        (1) | 0 / 0 |