id | C00010319 |
---|---|
Name | Perilla ketone / 1-(3-Furanyl)-4-methyl-1-pentanone |
CAS RN | 553-84-4 |
Standard InChI | InChI=1S/C10H14O2/c1-8(2)3-4-10(11)9-5-6-12-7-9/h5-8H,3-4H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C10H14O2/c1-8(2)3-4-10(11)9-5-6-12-7-9/h5-8H,3-4H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3100 |
By standard InChI | CHEMBL469753 |
---|---|
By standard InChI Main Layer | CHEMBL469753 |
By LinkDB |
---|
By CAS RN | C015426 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Perilla frutescens | 48386 | Lamiaceae | asterids | Viridiplantae |
Perilla ocimoides | 4136 | Lamiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75762 | Transient receptor potential cation channel subfamily A member 1 | Unclassified protein | CHEMBL469753 |
CHEMBL1118242
(1)
|
1 / 0 |