| id | C00010779 |
|---|---|
| Name | alpha-Morroniside |
| CAS RN | 61849-88-5 |
| Standard InChI | InChI=1S/C17H26O11/c1-6-11-7(3-10(19)26-6)8(15(23)24-2)5-25-16(11)28-17-14(22)13(21)12(20)9(4-18)27-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9?,10-,11+,12+,13?,14-,16-,17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H26O11/c1-6-11-7(3-10(19)26-6)8(15(23)24-2)5-25-16(11)28-17-14(22)13(21)12(20)9(4-18)27-17/h5-7,9-14,16-22H,3-4H2,1-2H3 |
| Phytochemical cluster | No. 36 |
|---|---|
| KCF-S cluster | No. 56 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1209803 CHEMBL2136065 CHEMBL2152455 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Caprifoliaceae | 1 |
| Rubiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chione venosa (sw.) Urban var.venosa | 24966 | Rubiaceae | asterids | Viridiplantae |
| Lonicera morrowii | 255350 | Caprifoliaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL2136065 |
CHEMBL2114780
(1)
|
0 / 0 |