| id | C00010779 | 
|---|---|
| Name | alpha-Morroniside | 
| CAS RN | 61849-88-5 | 
| Standard InChI | InChI=1S/C17H26O11/c1-6-11-7(3-10(19)26-6)8(15(23)24-2)5-25-16(11)28-17-14(22)13(21)12(20)9(4-18)27-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9?,10-,11+,12+,13?,14-,16-,17-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C17H26O11/c1-6-11-7(3-10(19)26-6)8(15(23)24-2)5-25-16(11)28-17-14(22)13(21)12(20)9(4-18)27-17/h5-7,9-14,16-22H,3-4H2,1-2H3 | 
| Phytochemical cluster | No. 36 | 
|---|---|
| KCF-S cluster | No. 56 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1209803 CHEMBL2136065 CHEMBL2152455 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 2 | 
| family name | count | 
|---|---|
| Caprifoliaceae | 1 | 
| Rubiaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Chione venosa (sw.) Urban var.venosa | 24966 | Rubiaceae | asterids | Viridiplantae | 
| Lonicera morrowii | 255350 | Caprifoliaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL2136065 | 
                        CHEMBL2114780
                        (1)
                         | 
                      0 / 0 |