| id | C00010843 |
|---|---|
| Name | Macropone |
| CAS RN | |
| Standard InChI | InChI=1S/C10H12O2/c1-7(2)8-3-4-9(6-11)10(12)5-8/h3-7,12H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H12O2/c1-7(2)8-3-4-9(6-11)10(12)5-8/h3-7,12H,1-2H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 3751 |
| By standard InChI | CHEMBL353354 |
|---|---|
| By standard InChI Main Layer | CHEMBL353354 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Myrtaceae | 1 |
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eucalyptus cneorifolia | 3932 | Myrtaceae | rosids | Viridiplantae |
| Thujopsis dolabrata | 13727 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL353354 |
CHEMBL813550
(1)
|
4 / 2 |