| id | C00010870 |
|---|---|
| Name | (+-)-Perrillic acid |
| CAS RN | 7694-45-3 |
| Standard InChI | InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12) |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 4414 |
| By standard InChI | CHEMBL1373981 |
|---|---|
| By standard InChI Main Layer | CHEMBL1256620 CHEMBL1373981 |
| By LinkDB | C11924 |
|---|
| By CAS RN | C078706 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Salvia dorisiana | 933131 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1256620 |
CHEMBL1741321
(1)
|
1 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1373981 |
CHEMBL1614544
(1)
|
11 / 10 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1256620 |
CHEMBL1614361
(1)
|
3 / 2 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1256620 |
CHEMBL1741325
(1)
|
0 / 1 |
| P11308 | Transcriptional regulator ERG | Unclassified protein | CHEMBL1256620 |
CHEMBL2114924
(1)
|
1 / 2 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1256620 |
CHEMBL1794401
(1)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL1373981 |
CHEMBL1794467
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1256620 |
CHEMBL1741322
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1256620 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1256620 |
CHEMBL1741324
(1)
|
0 / 1 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1256620 |
CHEMBL2354287
(1)
|
1 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C078706 | 387 |
RHOA
ARH12 ARHA RHO12 RHOH12 |
ras homolog family member A | Mevalonic Acid affects the reaction [perillic acid results in increased expression of RHOA protein] |
affects reaction
/ increases expression |
protein |
12671036
|
| C078706 | 387 |
RHOA
ARH12 ARHA RHO12 RHOH12 |
ras homolog family member A | perillic acid results in increased expression of RHOA protein |
increases expression
|
protein |
12671036
|
| C078706 | 388 |
RHOB
ARH6 ARHB MST081 MSTP081 RHOH6 |
ras homolog family member B | Mevalonic Acid affects the reaction [perillic acid results in increased expression of RHOB protein] |
affects reaction
/ increases expression |
protein |
12671036
|
| C078706 | 388 |
RHOB
ARH6 ARHB MST081 MSTP081 RHOH6 |
ras homolog family member B | perillic acid results in increased expression of RHOB protein |
increases expression
|
protein |
12671036
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #612219 | Ewing sarcoma; es |
P11308
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00024 | Prostate cancer |
P11308
(related)
|
| H00035 | Ewing's sarcoma |
P11308
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
Q13148
(related)
|