| id | C00010871 |
|---|---|
| Name | (S)-(-)-Perillaldehyde |
| CAS RN | 18031-40-8 |
| Standard InChI | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 848 |
| By standard InChI | CHEMBL442913 |
|---|---|
| By standard InChI Main Layer | CHEMBL442913 CHEMBL469537 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Perilla nankinensis | 4136 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL469537 |
CHEMBL1099470
(1)
|
0 / 0 |
| O75762 | Transient receptor potential cation channel subfamily A member 1 | Unclassified protein | CHEMBL469537 |
CHEMBL1118242
(1)
|
1 / 0 |