| id | C00010927 |
|---|---|
| Name | Terpinene-4-ol / (-)-Terpinene-4-ol / (R)-(-)-p-Menth-1-en-4-ol |
| CAS RN | 20126-76-5 |
| Standard InChI | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2215 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL507795 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Myrtaceae | 3 |
| Rutaceae | 1 |
| Asteraceae | 1 |
| Ganodermataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eucalyptus dives | 87671 | Myrtaceae | rosids | Viridiplantae |
| Ganoderma lucidum | 5315 | Ganodermataceae | Fungi | |
| Leptospermum scoparium | 295139 | Myrtaceae | rosids | Viridiplantae |
| Lychnophora ericoides Mart. | 594549 | Asteraceae | asterids | Viridiplantae |
| Myrtus communis | 119949 | Myrtaceae | rosids | Viridiplantae |
| Zanthoxylum rhetsa | 67937 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22310 | UDP-glucuronosyltransferase 1-4 | Enzyme | CHEMBL507795 |
CHEMBL1908082
(1)
|
3 / 0 |