| id | C00011322 | 
|---|---|
| Name | Phomin / Cytochalasin B | 
| CAS RN | 14930-96-2 | 
| Standard InChI | InChI=1S/C29H37NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,22-24,26-27,31,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34)/b14-8+,16-15+/t18-,19-,22-,23+,24?,26?,27-,29-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C29H37NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,22-24,26-27,31,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 480 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL56897 CHEMBL411729 CHEMBL1422227 CHEMBL1554187 | 
| By LinkDB | C19954 | 
|---|
| By CAS RN | D003571 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Pleosporaceae | 3 | 
| Didymellaceae | 2 | 
| Gnomoniaceae | 1 | 
| Hypocreaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL1554187 | CHEMBL1613842
                        (1) | 4 / 2 | 
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL1422227 | CHEMBL1738312
                        (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL56897 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL411729 | CHEMBL965571
                        (1)
                        CHEMBL965576
                        (1) | 0 / 0 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1422227 | CHEMBL1614544
                        (1) | 11 / 10 | 
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL411729 | CHEMBL965574
                        (1) | 1 / 1 | 
| P20701 | Integrin alpha-L | Membrane receptor | CHEMBL411729 | CHEMBL982328
                        (1)
                        CHEMBL982330
                        (1) CHEMBL945484 (1) CHEMBL945487 (1) CHEMBL1016754 (1) CHEMBL1016757 (1) | 0 / 0 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1554187 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL56897 CHEMBL1554187 | CHEMBL2114843
                        (2)
                        CHEMBL2114780
                        (2) | 0 / 0 | 
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL1422227 | CHEMBL1613838
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1554187 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1554187 | CHEMBL1794401
                        (1) | 0 / 0 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1422227 | CHEMBL1614521
                        (1) | 0 / 0 | 
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL1422227 | CHEMBL1614342
                        (1) | 1 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1554187 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL56897 CHEMBL1554187 | CHEMBL1738184
                        (3) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1554187 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL56897 CHEMBL1554187 | CHEMBL2354311
                        (2) | 1 / 0 | 
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL56897 | CHEMBL2114913
                        (1) | 0 / 3 | 
| Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL56897 | CHEMBL2354301
                        (1) | 1 / 2 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | [Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK1 protein | affects cotreatment / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | [Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK3 protein | affects cotreatment / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | [Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein | affects cotreatment / increases secretion | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | Dexamethasone analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK1 protein] | affects cotreatment / decreases reaction / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK3 protein] | affects cotreatment / decreases reaction / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 727 | C5 C5a C5b CPAMD4 | complement component 5 | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 847 | CAT | catalase (EC:1.11.1.6) | Cytochalasin B inhibits the reaction [Dehydroascorbic Acid results in increased expression of CAT protein] | decreases reaction / increases expression | protein | 20166893 | 
| D003571 | 1437 | CSF2 GMCSF | colony stimulating factor 2 (granulocyte-macrophage) | Cytochalasin B inhibits the reaction [kaempferol results in increased secretion of CSF2 protein] | decreases reaction / increases secretion | protein | 18346843 | 
| D003571 | 1437 | CSF2 GMCSF | colony stimulating factor 2 (granulocyte-macrophage) | Cytochalasin B inhibits the reaction [Quercetin results in increased secretion of CSF2 protein] | decreases reaction / increases secretion | protein | 18346843 | 
| D003571 | 1991 | ELANE ELA2 GE HLE HNE NE PMN-E SCN1 | elastase, neutrophil expressed (EC:3.4.21.37) | [Cytochalasin B co-treated with N-Formylmethionine Leucyl-Phenylalanine] results in increased secretion of ELANE protein | affects cotreatment / increases secretion | protein | 19686721 | 
| D003571 | 1991 | ELANE ELA2 GE HLE HNE NE PMN-E SCN1 | elastase, neutrophil expressed (EC:3.4.21.37) | pirinixic acid analog inhibits the reaction [[Cytochalasin B co-treated with N-Formylmethionine Leucyl-Phenylalanine] results in increased secretion of ELANE protein] | affects cotreatment / decreases reaction / increases secretion | protein | 19686721 | 
| D003571 | 2056 | EPO EP MVCD2 | erythropoietin | [Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein | affects cotreatment / increases secretion | protein | 18776917 | 
| D003571 | 2056 | EPO EP MVCD2 | erythropoietin | [Cytochalasin B co-treated with IL5 protein] results in increased secretion of EPO protein | affects cotreatment / increases secretion | protein | 18776917 | 
| D003571 | 2056 | EPO EP MVCD2 | erythropoietin | Dexamethasone analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 2056 | EPO EP MVCD2 | erythropoietin | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 2056 | EPO EP MVCD2 | erythropoietin | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with IL5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 3553 | IL1B IL-1 IL1-BETA IL1F2 | interleukin 1, beta | Cytochalasin B inhibits the reaction [[Alum Compounds co-treated with K-12 lipopolysaccharide] results in increased secretion of IL1B protein modified form] | affects cotreatment / decreases reaction / increases secretion | protein | 17404311 | 
| D003571 | 3567 | IL5 EDF IL-5 TRF | interleukin 5 (colony-stimulating factor, eosinophil) | [Cytochalasin B co-treated with IL5 protein] results in increased secretion of EPO protein | affects cotreatment / increases secretion | protein | 18776917 | 
| D003571 | 3567 | IL5 EDF IL-5 TRF | interleukin 5 (colony-stimulating factor, eosinophil) | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with IL5 protein] results in increased secretion of EPO protein] | affects cotreatment / decreases reaction / increases secretion | protein | 18776917 | 
| D003571 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | [Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK1 protein | affects cotreatment / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK1 protein] | affects cotreatment / decreases reaction / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | [Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK3 protein | affects cotreatment / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | resveratrol analog inhibits the reaction [[Cytochalasin B co-treated with C5 protein] results in increased phosphorylation of and results in increased activity of MAPK3 protein] | affects cotreatment / decreases reaction / increases activity / increases phosphorylation | protein | 18776917 | 
| D003571 | 6513 | SLC2A1 DYT17 DYT18 DYT9 EIG12 GLUT GLUT1 GLUT1DS HTLVR PED | solute carrier family 2 (facilitated glucose transporter), member 1 | Cytochalasin B affects the folding of SLC2A1 protein | affects folding | protein | 22363641 | 
| D003571 | 6513 | SLC2A1 DYT17 DYT18 DYT9 EIG12 GLUT GLUT1 GLUT1DS HTLVR PED | solute carrier family 2 (facilitated glucose transporter), member 1 | Cytochalasin B inhibits the reaction [SLC2A1 protein results in increased transport of Glucose] | decreases reaction / increases transport | protein | 8457197 | 
| D003571 | 6514 | SLC2A2 GLUT2 | solute carrier family 2 (facilitated glucose transporter), member 2 | Cytochalasin B inhibits the reaction [SLC2A2 protein results in increased transport of Deoxyglucose] | decreases reaction / increases transport | protein | 8457197 | 
| D003571 | 6515 | SLC2A3 GLUT3 | solute carrier family 2 (facilitated glucose transporter), member 3 | Cytochalasin B inhibits the reaction [SLC2A3 protein results in increased transport of Deoxyglucose] | decreases reaction / increases transport | protein | 8457197 | 
| D003571 | 6648 | SOD2 IPOB MNSOD MVCD6 | superoxide dismutase 2, mitochondrial (EC:1.15.1.1) | Cytochalasin B inhibits the reaction [Dehydroascorbic Acid results in increased expression of SOD2 protein] | decreases reaction / increases expression | protein | 20166893 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300615 | Brunner syndrome | P21397 | 
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #218700 | Hypothyroidism, congenital, nongoitrous, 2; chng2 | Q06710 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #257220 | Niemann-pick disease, type c1; npc1 | O15118 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #253300 | Spinal muscular atrophy, type i; sma1 | Q16637 | 
| #253550 | Spinal muscular atrophy, type ii; sma2 | Q16637 | 
| #253400 | Spinal muscular atrophy, type iii; sma3 | Q16637 | 
| #271150 | Spinal muscular atrophy, type iv; sma4 | Q16637 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00136 | Niemann-Pick disease type C (NPC) | O15118
                            (related) | 
| H00081 | Hashimoto's thyroiditis | P01215
                            (marker) | 
| H00082 | Graves' disease | P01215
                            (marker) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P01215
                            (marker) Q06710 (related) | 
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00548 | Brunner syndrome | P21397
                            (related) | 
| H00032 | Thyroid cancer | Q06710
                            (related) | 
| H00455 | Spinal muscular atrophy (SMA) | Q16637
                            (related) Q16637 (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) |