| id | C00001172 |
|---|---|
| Name | Sequoyitol / 5-O-Methyl-myo-inositol |
| CAS RN | 523-92-2 |
| Standard InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4?,5?,6-,7+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 795 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL171890 CHEMBL501109 CHEMBL493737 CHEMBL460057 |
| By LinkDB | C03365 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 3 |
| rosids | 1 |
| family name | count |
|---|---|
| Taxaceae | 2 |
| Cupressaceae | 1 |
| Rutaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Amentotaxus yunnanensis | 89479 | Taxaceae | Spermatophyta | Viridiplantae |
| Melicope micrococca | 1226092 | Rutaceae | rosids | Viridiplantae |
| Sequoia sempervirens | 28980 | Cupressaceae | Spermatophyta | Viridiplantae |
| Taxus baccata | 25629 | Taxaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL171890 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL171890 |
CHEMBL1794569
(1)
|
1 / 1 |