| id | C00001172 | 
|---|---|
| Name | Sequoyitol / 5-O-Methyl-myo-inositol | 
| CAS RN | 523-92-2 | 
| Standard InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2?,3-,4?,5?,6-,7+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 795 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL171890 CHEMBL501109 CHEMBL493737 CHEMBL460057 | 
| By LinkDB | C03365 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Spermatophyta | 3 | 
| rosids | 1 | 
| family name | count | 
|---|---|
| Taxaceae | 2 | 
| Cupressaceae | 1 | 
| Rutaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Amentotaxus yunnanensis | 89479 | Taxaceae | Spermatophyta | Viridiplantae | 
| Melicope micrococca | 1226092 | Rutaceae | rosids | Viridiplantae | 
| Sequoia sempervirens | 28980 | Cupressaceae | Spermatophyta | Viridiplantae | 
| Taxus baccata | 25629 | Taxaceae | Spermatophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL171890 | CHEMBL2114843
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL171890 | CHEMBL1794569
                        (1) | 1 / 1 |