| id | C00011727 |
|---|---|
| Name | Aristolactone |
| CAS RN | 6790-85-8 |
| Standard InChI | InChI=1S/C15H20O2/c1-10(2)13-8-7-11(3)5-4-6-12-9-14(13)17-15(12)16/h5,9,13-14H,1,4,6-8H2,2-3H3/b11-5+/t13-,14-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H20O2/c1-10(2)13-8-7-11(3)5-4-6-12-9-14(13)17-15(12)16/h5,9,13-14H,1,4,6-8H2,2-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3231 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2333547 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 4 |
| family name | count |
|---|---|
| Aristolochiaceae | 4 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL2333547 |
CHEMBL2346141
(1)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL2333547 |
CHEMBL2346141
(1)
|
0 / 0 |