| id | C00011864 |
|---|---|
| Name | Eupalinin A |
| CAS RN | 72947-94-5 |
| Standard InChI | InChI=1S/C22H28O8/c1-6-14(10-23)21(26)29-17-9-22(5)18(30-22)8-15(27-13(4)24)11(2)7-16-19(17)12(3)20(25)28-16/h6-7,15-19,23H,3,8-10H2,1-2,4-5H3/b11-7-,14-6+/t15-,16-,17+,18+,19?,22-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H28O8/c1-6-14(10-23)21(26)29-17-9-22(5)18(30-22)8-15(27-13(4)24)11(2)7-16-19(17)12(3)20(25)28-16/h6-7,15-19,23H,3,8-10H2,1-2,4-5H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 94 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL258867 CHEMBL490650 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eupatorium lindleyanum | 103753 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL258867 |
CHEMBL937115
(1)
|
4 / 1 |