| id | C00001188 |
|---|---|
| Name | Isocitric acid |
| CAS RN | 6061-97-8 |
| Standard InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7222 |
| By standard InChI | CHEMBL390356 |
|---|---|
| By standard InChI Main Layer | CHEMBL390356 CHEMBL539669 CHEMBL2338331 |
| By LinkDB | C00451 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Crassulaceae | 1 |
| Enterobacteriaceae | 1 |
| Fabaceae | 1 |
| Rosaceae | 1 |
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Bryophyllum calycinum | 92858 | Crassulaceae | eudicotyledons | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria | |
| Phaseolus vulgaris | 3885 | Fabaceae | rosids | Viridiplantae |
| Rubus spp. | 23216 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9GZT9 | Egl nine homolog 1 | Enzyme | CHEMBL539669 |
CHEMBL2318589
(1)
CHEMBL2318597
(1)
|
1 / 1 |
| Q9C0B1 | Alpha-ketoglutarate-dependent dioxygenase FTO | Unclassified protein | CHEMBL2338331 |
CHEMBL2344107
(1)
|
1 / 2 |