| id | C00001206 |
|---|---|
| Name | L-(+)-Tartaric acid |
| CAS RN | 87-69-4 |
| Standard InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5453 |
| By standard InChI | CHEMBL1236315 |
|---|---|
| By standard InChI Main Layer | CHEMBL225983 CHEMBL1200861 CHEMBL1236315 |
| By LinkDB | C00898 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| family name | count |
|---|---|
| Moraceae | 1 |
| Geraniaceae | 1 |
| Fabaceae | 1 |
| Vitaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morus indica | 248361 | Moraceae | rosids | Viridiplantae |
| Pelargonium spp. | 4030 | Geraniaceae | rosids | Viridiplantae |
| Tamarindus indica | 58860 | Fabaceae | rosids | Viridiplantae |
| Vitis vinifera | 29760 | Vitaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1200861 |
CHEMBL1741321
(1)
|
1 / 0 |
| Q99489 | D-aspartate oxidase | Enzyme | CHEMBL225983 |
CHEMBL2327933
(2)
|
0 / 0 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1200861 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1200861 |
CHEMBL1741325
(1)
|
0 / 1 |
| P14920 | D-amino-acid oxidase | Enzyme | CHEMBL225983 |
CHEMBL2327932
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1200861 CHEMBL1236315 |
CHEMBL2114843
(2)
CHEMBL2114780
(1)
|
0 / 0 |
| Q9GZT4 | Serine racemase | Enzyme | CHEMBL225983 |
CHEMBL2327930
(2)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1200861 |
CHEMBL1741322
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1200861 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1200861 |
CHEMBL1741324
(1)
|
0 / 1 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL1200861 CHEMBL1236315 |
CHEMBL1737991
(2)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|