| id | C00001234 |
|---|---|
| Name | Palmitoleic acid |
| CAS RN | 373-49-9 |
| Standard InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
| Standard InChI (Main Layer) | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18) |
| Phytochemical cluster | No. 68 |
|---|---|
| KCF-S cluster | No. 184 |
| By standard InChI | CHEMBL453509 |
|---|---|
| By standard InChI Main Layer | CHEMBL453509 |
| By LinkDB | C08362 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Arecaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Elaeis guineensis | 51953 | Arecaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL453509 |
CHEMBL1027138
(1)
|
5 / 3 |
| P13726 | Tissue factor | Membrane receptor | CHEMBL453509 |
CHEMBL995691
(1)
|
0 / 0 |