| id | C00012731 |
|---|---|
| Name | Viscic acid / 3alpha-Hydroxycostic acid / [2R-(2alpha,4aalpha,7beta,8abeta)]-Decahydro-7-hydroxy-4a-methyl-alpha,8-bis(methylene)-2-naphthaleneacetic acid |
| CAS RN | 100664-47-9 |
| Standard InChI | InChI=1S/C15H22O3/c1-9(14(17)18)11-4-6-15(3)7-5-13(16)10(2)12(15)8-11/h11-13,16H,1-2,4-8H2,3H3,(H,17,18)/t11-,12+,13-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O3/c1-9(14(17)18)11-4-6-15(3)7-5-13(16)10(2)12(15)8-11/h11-13,16H,1-2,4-8H2,3H3,(H,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 978 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| family name | count |
|---|---|
| Asteraceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dittrichia graveolens (L.) GREUTER | 56524 | Asteraceae | asterids | Viridiplantae |
| Dittrichia viscosa | 56525 | Asteraceae | asterids | Viridiplantae |
| Inula viscosa | 56525 | Asteraceae | asterids | Viridiplantae |