| id | C00001364 |
|---|---|
| Name | L-Homoarginine |
| CAS RN | 156-86-5 |
| Standard InChI | InChI=1S/C7H16N4O2/c8-5(6(12)13)3-1-2-4-11-7(9)10/h5H,1-4,8H2,(H,12,13)(H4,9,10,11)/t5-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H16N4O2/c8-5(6(12)13)3-1-2-4-11-7(9)10/h5H,1-4,8H2,(H,12,13)(H4,9,10,11) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1782 |
| By standard InChI | CHEMBL589752 |
|---|---|
| By standard InChI Main Layer | CHEMBL589752 |
| By LinkDB | C01924 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lathyrus cicera | 3856 | Fabaceae | rosids | Viridiplantae |
| Lathyrus sativus | 3860 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9Y263 | Phospholipase A-2-activating protein | Unclassified protein | CHEMBL589752 |
CHEMBL1074487
(1)
|
0 / 0 |
| P09923 | Intestinal-type alkaline phosphatase | Enzyme | CHEMBL589752 |
CHEMBL1074489
(1)
|
0 / 0 |
| P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | Enzyme | CHEMBL589752 |
CHEMBL1074488
(1)
|
3 / 1 |