| id | C00001365 |
|---|---|
| Name | L-Homocysteine |
| CAS RN | 6027-13-0 |
| Standard InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2426 |
| By standard InChI | CHEMBL469662 |
|---|---|
| By standard InChI Main Layer | CHEMBL310604 CHEMBL469662 |
| By LinkDB | C00155 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Enterobacteriaceae | 1 |
| Amaranthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria | |
| Spinacia oleracea | 3562 | Amaranthaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O94760 | N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 | Enzyme | CHEMBL469662 |
CHEMBL981895
(1)
CHEMBL981896
(1)
CHEMBL981905 (1) |
0 / 0 |