| id | C00001370 |
|---|---|
| Name | trans-4-Hydroxy-L-proline |
| CAS RN | 51-35-4 |
| Standard InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9) |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 1523 |
| By standard InChI | CHEMBL352418 |
|---|---|
| By standard InChI Main Layer | CHEMBL352418 CHEMBL1213475 CHEMBL1229563 CHEMBL1233477 |
| By LinkDB | C01157 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Afzelia bella | 162642 | Fabaceae | rosids | Viridiplantae |
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9GZT9 | Egl nine homolog 1 | Enzyme | CHEMBL352418 |
CHEMBL1804278
(1)
|
1 / 1 |
| Q7Z2H8 | Proton-coupled amino acid transporter 1 | Unclassified protein | CHEMBL352418 CHEMBL1229563 CHEMBL1233477 |
CHEMBL1919336
(6)
|
0 / 0 |