| id | C00001380 |
|---|---|
| Name | 3-Methylamino-L-alanine |
| CAS RN | 15920-93-1 |
| Standard InChI | InChI=1S/C4H10N2O2/c1-6-2-3(5)4(7)8/h3,6H,2,5H2,1H3,(H,7,8)/t3-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H10N2O2/c1-6-2-3(5)4(7)8/h3,6H,2,5H2,1H3,(H,7,8) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1538 |
| By standard InChI | CHEMBL11488 |
|---|---|
| By standard InChI Main Layer | CHEMBL11488 CHEMBL1486321 |
| By LinkDB | C08291 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Cycadaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cycas circinalis | 3397 | Cycadaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1486321 |
CHEMBL1614364
(1)
|
1 / 1 |