| id | C00001394 | 
|---|---|
| Name | L-Threonine | 
| CAS RN | 72-19-5 | 
| Standard InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6720 | 
| By standard InChI | CHEMBL291747 | 
|---|---|
| By standard InChI Main Layer | CHEMBL30037 CHEMBL291747 CHEMBL59238 CHEMBL319354 CHEMBL555743 CHEMBL1734340 | 
| By LinkDB | C00188 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Brassicaceae | 1 | 
| Enterobacteriaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae | 
| Escherichia coli K12 | 83333 | Enterobacteriaceae | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL30037 | CHEMBL1614544
                        (1) | 11 / 10 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL555743 | CHEMBL1614458
                        (1) | 0 / 0 | 
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1734340 | CHEMBL1738606
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1734340 | CHEMBL1794536
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) |