| id | C00001398 |
|---|---|
| Name | L-Valine |
| CAS RN | 72-18-4 |
| Standard InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4144 |
| By standard InChI | CHEMBL43068 |
|---|---|
| By standard InChI Main Layer | CHEMBL11257 CHEMBL43068 CHEMBL1232398 |
| By LinkDB | C00183 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P46059 | Solute carrier family 15 member 1 | Dipeptide | CHEMBL43068 |
CHEMBL863210
(1)
CHEMBL863211
(1)
CHEMBL863212 (1) CHEMBL863213 (1) |
0 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1232398 |
CHEMBL1614544
(1)
|
11 / 10 |
| Q7Z2H8 | Proton-coupled amino acid transporter 1 | Unclassified protein | CHEMBL1232398 |
CHEMBL1919336
(2)
|
0 / 0 |
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL1232398 |
CHEMBL1613933
(1)
|
0 / 1 |
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL1232398 |
CHEMBL1613933
(1)
|
1 / 6 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #601399 | Platelet disorder, familial, with associated myeloid malignancy |
Q01196
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q01196
(related)
Q01196 (marker) |
| H00003 | Acute myeloid leukemia (AML) |
Q01196
(related)
Q01196 (marker) Q13951 (marker) |
| H00004 | Chronic myeloid leukemia (CML) |
Q01196
(related)
|
| H00978 | Thrombocytopenia (THC) |
Q01196
(related)
|