| id | C00001407 |
|---|---|
| Name | N,N-Dimethyltryptamine |
| CAS RN | 61-50-7 |
| Standard InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 1385 |
| By standard InChI | CHEMBL12420 |
|---|---|
| By standard InChI Main Layer | CHEMBL12420 |
| By LinkDB | C08302 |
|---|
| By CAS RN | D004130 |
|---|
| class name | count |
|---|---|
| rosids | 17 |
| asterids | 2 |
| Liliopsida | 1 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 16 |
| Apocynaceae | 1 |
| Poaceae | 1 |
| Thorectidae | 1 |
| Rubiaceae | 1 |
| Rutaceae | 1 |
| Lycopodiaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL12420 |
CHEMBL617410
(1)
|
0 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL12420 |
CHEMBL615729
(1)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL12420 |
CHEMBL617282
(1)
|
0 / 0 |
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL12420 |
CHEMBL993916
(1)
|
1 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D004130 | 3356 |
HTR2A
5-HT2A HTR2 |
5-hydroxytryptamine (serotonin) receptor 2A, G protein-coupled | HTR2A gene SNP results in decreased susceptibility to N,N-Dimethyltryptamine |
decreases response to substance
|
gene |
16314884
|
| D004130 | 3356 |
HTR2A
5-HT2A HTR2 |
5-hydroxytryptamine (serotonin) receptor 2A, G protein-coupled | HTR2A protein affects the susceptibility to N,N-Dimethyltryptamine |
affects response to substance
|
protein |
16314884
|
| D004130 | 3356 |
HTR2A
5-HT2A HTR2 |
5-hydroxytryptamine (serotonin) receptor 2A, G protein-coupled | N,N-Dimethyltryptamine binds to and results in increased activity of HTR2A protein |
affects binding
/ increases activity |
protein |
16314884
|