| id | C00014177 |
|---|---|
| Name | Monotesone B / 5,7,3',5'-Tetrahydroxy-6,8-diprenylflavanone |
| CAS RN | 208596-56-9 |
| Standard InChI | InChI=1S/C25H28O6/c1-13(2)5-7-18-23(29)19(8-6-14(3)4)25-22(24(18)30)20(28)12-21(31-25)15-9-16(26)11-17(27)10-15/h5-6,9-11,21,26-27,29-30H,7-8,12H2,1-4H3/t21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H28O6/c1-13(2)5-7-18-23(29)19(8-6-14(3)4)25-22(24(18)30)20(28)12-21(31-25)15-9-16(26)11-17(27)10-15/h5-6,9-11,21,26-27,29-30H,7-8,12H2,1-4H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 19 |
| By standard InChI | CHEMBL1689341 |
|---|---|
| By standard InChI Main Layer | CHEMBL1689341 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Dipterocarpaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Monotes engleri | 65012 | Dipterocarpaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL1689341 |
CHEMBL1694230
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|