| id | C00001419 |
|---|---|
| Name | Mescaline |
| CAS RN | 54-04-6 |
| Standard InChI | InChI=1S/C11H17NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4-5,12H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H17NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4-5,12H2,1-3H3 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 723 |
| By standard InChI | CHEMBL26687 |
|---|---|
| By standard InChI Main Layer | CHEMBL26687 |
| By LinkDB | C06546 |
|---|
| By CAS RN | D008635 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| rosids | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acacia rigidula Benth. | 205076 | Fabaceae | rosids | Viridiplantae |
| Anhalonium lewinii | ||||
| Lophophora williamsii | 130138 | Cactaceae | eudicotyledons | Viridiplantae |
| Trichocereus pachanoi | 153898 | Cactaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL26687 |
CHEMBL617374
(1)
CHEMBL617377
(1)
|
0 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL26687 |
CHEMBL617064
(1)
CHEMBL617069
(1)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL26687 |
CHEMBL617898
(1)
CHEMBL617902
(1)
|
0 / 0 |