id | C00001427 |
---|---|
Name | Psilocin |
CAS RN | 520-53-6 |
Standard InChI | InChI=1S/C12H16N2O/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10/h3-5,8,13,15H,6-7H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C12H16N2O/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10/h3-5,8,13,15H,6-7H2,1-2H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 1385 |
By standard InChI | CHEMBL65547 |
---|---|
By standard InChI Main Layer | CHEMBL65547 |
By LinkDB | C08312 |
---|
By CAS RN | C009105 |
---|
class name | count |
---|
family name | count |
---|---|
Strophariaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Psilocybe mexicana | 891396 | Strophariaceae | Fungi |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL65547 |
CHEMBL883724
(1)
|
0 / 0 |
P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL65547 |
CHEMBL883722
(1)
|
0 / 0 |
P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL65547 |
CHEMBL883723
(1)
|
0 / 0 |
P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL65547 |
CHEMBL616143
(1)
|
1 / 0 |