| id | C00014661 |
|---|---|
| Name | 4'-Chloroaurone |
| CAS RN | 38216-61-4 |
| Standard InChI | InChI=1S/C15H9ClO2/c16-11-7-5-10(6-8-11)9-14-15(17)12-3-1-2-4-13(12)18-14/h1-9H/b14-9- |
| Standard InChI (Main Layer) | InChI=1S/C15H9ClO2/c16-11-7-5-10(6-8-11)9-14-15(17)12-3-1-2-4-13(12)18-14/h1-9H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6650 |
| By standard InChI | CHEMBL596254 |
|---|---|
| By standard InChI Main Layer | CHEMBL596254 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Dictyotaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Spatoglossum variabile | 157006 | Dictyotaceae | Eukaryota |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL596254 |
CHEMBL1947640
(1)
|
0 / 0 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL596254 |
CHEMBL1947641
(1)
|
1 / 1 |