| id | C00014944 |
|---|---|
| Name | Chandrananimycin A |
| CAS RN | 664355-12-8 |
| Standard InChI | InChI=1S/C14H10N2O4/c1-7(17)15-8-5-9-13(6-11(8)19)20-12-4-2-3-10(18)14(12)16-9/h2-6,18H,1H3,(H,15,17) |
| Standard InChI (Main Layer) | InChI=1S/C14H10N2O4/c1-7(17)15-8-5-9-13(6-11(8)19)20-12-4-2-3-10(18)14(12)16-9/h2-6,18H,1H3,(H,15,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1379 |
| By standard InChI | CHEMBL2322651 |
|---|---|
| By standard InChI Main Layer | CHEMBL2322651 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thermomonosporaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Actinomadura sp. M048 | 1988 | Thermomonosporaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL2322651 |
CHEMBL2330523
(1)
CHEMBL2330524
(1)
CHEMBL2330525 (1) |
0 / 0 |