| id | C00001508 |
|---|---|
| Name | 5-Ribosyluracil |
| CAS RN | 1445-07-4 |
| Standard InChI | InChI=1S/C9H12N2O6/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,16)/t4-,5+,6?,7+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C9H12N2O6/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,16) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3929 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL603512 |
| By LinkDB | C02067 |
|---|
| By CAS RN | D011560 |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Rhizobiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Agrobacterium tumefaciens | 358 | Rhizobiaceae | Bacteria | |
| Cicer arietinum | 3827 | Fabaceae | rosids | Viridiplantae |
| Phaseolus vulgaris | 3885 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P19971 | Thymidine phosphorylase | Enzyme | CHEMBL603512 |
CHEMBL815498
(1)
|
1 / 1 |