| id | C00015199 |
|---|---|
| Name | Dihydrooxyresveratrol / 2,3',4,5'-Tetrahydroxystilbene |
| CAS RN | 24082-42-6 |
| Standard InChI | InChI=1S/C14H14O4/c15-11-4-3-10(14(18)8-11)2-1-9-5-12(16)7-13(17)6-9/h3-8,15-18H,1-2H2 |
| Standard InChI (Main Layer) | InChI=1S/C14H14O4/c15-11-4-3-10(14(18)8-11)2-1-9-5-12(16)7-13(17)6-9/h3-8,15-18H,1-2H2 |
| Phytochemical cluster | No. 26 |
|---|---|
| KCF-S cluster | No. 242 |
| By standard InChI | CHEMBL221291 |
|---|---|
| By standard InChI Main Layer | CHEMBL221291 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morus alba | 3498 | Moraceae | rosids | Viridiplantae |
| Morus indica | 248361 | Moraceae | rosids | Viridiplantae |
| Morus laevigata | 191188 | Moraceae | rosids | Viridiplantae |
| Morus serrata | 249543 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL221291 |
CHEMBL854612
(1)
CHEMBL854613
(1)
|
4 / 2 |