| Name |
Flavanthrin / Blestriarene A / 4,4'-Dimethoxy-2,2',7,7'-tetrahydroxy-9,9',10,10'-tetrahydro-[1,1'-biphenanthrene] |
| CAS RN |
126721-53-7 / 120090-80-4 |
| Standard InChI |
InChI=1S/C30H26O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h5-6,9-14,31-34H,3-4,7-8H2,1-2H3 |
| Standard InChI (Main Layer) |
InChI=1S/C30H26O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h5-6,9-14,31-34H,3-4,7-8H2,1-2H3 |