| id | C00015755 |
|---|---|
| Name | Coeloginin |
| CAS RN | 82358-34-7 |
| Standard InChI | InChI=1S/C17H14O6/c1-21-15-9-4-3-7-5-8(18)6-10-11(7)12(9)13(17(20)23-10)14(19)16(15)22-2/h5-6,18-19H,3-4H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-21-15-9-4-3-7-5-8(18)6-10-11(7)12(9)13(17(20)23-10)14(19)16(15)22-2/h5-6,18-19H,3-4H2,1-2H3 |
| Phytochemical cluster | No. 17 |
|---|---|
| KCF-S cluster | No. 54 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 3 |
| family name | count |
|---|---|
| Orchidaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Coelogyne cristata | 38221 | Orchidaceae | Liliopsida | Viridiplantae |
| Coelogyne ochracea | 466244 | Orchidaceae | Liliopsida | Viridiplantae |
| Coelogyne ovalis | 1350402 | Orchidaceae | Liliopsida | Viridiplantae |