| id | C00015762 |
|---|---|
| Name | 3-Methoxy-5-phenethylphenol / Dihydropinosylvin monomethyl ether |
| CAS RN | 17635-59-5 |
| Standard InChI | InChI=1S/C15H16O2/c1-17-15-10-13(9-14(16)11-15)8-7-12-5-3-2-4-6-12/h2-6,9-11,16H,7-8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H16O2/c1-17-15-10-13(9-14(16)11-15)8-7-12-5-3-2-4-6-12/h2-6,9-11,16H,7-8H2,1H3 |
| Phytochemical cluster | No. 26 |
|---|---|
| KCF-S cluster | No. 242 |
| By standard InChI | CHEMBL389172 |
|---|---|
| By standard InChI Main Layer | CHEMBL389172 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 16 |
| family name | count |
|---|---|
| Pinaceae | 16 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL389172 |
CHEMBL914259
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL389172 |
CHEMBL914258
(1)
|
0 / 0 |