| id | C00001579 | 
|---|---|
| Name | Pancratistatin / (+)-Pancratistatin | 
| CAS RN | 96203-70-2 | 
| Standard InChI | InChI=1S/C14H15NO8/c16-8-5-3-1-4-13(23-2-22-4)9(17)6(3)14(21)15-7(5)10(18)12(20)11(8)19/h1,5,7-8,10-12,16-20H,2H2,(H,15,21)/t5-,7-,8-,10+,11+,12+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C14H15NO8/c16-8-5-3-1-4-13(23-2-22-4)9(17)6(3)14(21)15-7(5)10(18)12(20)11(8)19/h1,5,7-8,10-12,16-20H,2H2,(H,15,21) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4012 | 
| By standard InChI | CHEMBL419335 | 
|---|---|
| By standard InChI Main Layer | CHEMBL419335 CHEMBL223299 CHEMBL1736766 CHEMBL2036086 | 
| By LinkDB | C08535 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 8 | 
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Amaryllidaceae | 8 | 
| Ranunculaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1736766 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1736766 | CHEMBL1794584
                        (1) | 2 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1736766 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1736766 | CHEMBL2114810
                        (1) | 7 / 3 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL419335 | CHEMBL1029448
                        (1) | 0 / 1 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1736766 | CHEMBL1738184
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1736766 | CHEMBL2354311
                        (1) | 1 / 0 | 
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL1736766 | CHEMBL2114913
                        (1) | 0 / 3 | 
| Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL1736766 | CHEMBL2354301
                        (1) | 1 / 2 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah | P63092 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #218700 | Hypothyroidism, congenital, nongoitrous, 2; chng2 | Q06710 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #174800 | Mccune-albright syndrome; mas | P63092 | 
| #166350 | Osseous heteroplasia, progressive; poh | P63092 | 
| #102200 | Pituitary adenoma, growth hormone-secreting | P63092 | 
| #103580 | Pseudohypoparathyroidism, type ia; php1a | P63092 | 
| #603233 | Pseudohypoparathyroidism, type ib; php1b | P63092 | 
| #612462 | Pseudohypoparathyroidism, type ic; php1c | P63092 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00081 | Hashimoto's thyroiditis | P01215
                            (marker) | 
| H00082 | Graves' disease | P01215
                            (marker) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P01215
                            (marker) Q06710 (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00244 | Pseudohypoparathyroidism | P63092
                            (related) | 
| H00441 | Progressive osseous heteroplasia (POH) | P63092
                            (related) | 
| H00501 | Fibrous dysplasia, polyostotic | P63092
                            (related) | 
| H00032 | Thyroid cancer | Q06710
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) |