| id | C00015837 |
|---|---|
| Name | Pallidol / (-)-Pallidol |
| CAS RN | 105037-88-5 |
| Standard InChI | InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-25-19(9-17(31)11-21(25)33)28-24(14-3-7-16(30)8-4-14)26-20(27(23)28)10-18(32)12-22(26)34/h1-12,23-24,27-34H/t23-,24?,27+,28+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-25-19(9-17(31)11-21(25)33)28-24(14-3-7-16(30)8-4-14)26-20(27(23)28)10-18(32)12-22(26)34/h1-12,23-24,27-34H |
| Phytochemical cluster | No. 30 |
|---|---|
| KCF-S cluster | No. 108 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL480462 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ampelopsis brevipedunculata var hancei | 125007 | Vitaceae | rosids | Viridiplantae |
| Cissus pallida | 149357 | Vitaceae | rosids | Viridiplantae |
| Cissus quadrangularis | 165298 | Vitaceae | rosids | Viridiplantae |
| Parthenocissus tricuspidata | 345127 | Vitaceae | rosids | Viridiplantae |
| Vitis vinifera | 29760 | Vitaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL480462 |
CHEMBL947577
(1)
CHEMBL967380
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL480462 |
CHEMBL947576
(1)
|
0 / 0 |