| id | C00016089 |
|---|---|
| Name | Tetrachloro-pyrocatechol |
| CAS RN | 1198-55-6 |
| Standard InChI | InChI=1S/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| Standard InChI (Main Layer) | InChI=1S/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2865 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C18240 |
|---|
| By CAS RN | C423629 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Tricholomataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mycena sp. 96097 | 41247 | Tricholomataceae | Fungi |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C423629 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | 3,4,5,6-tetrachlorocatechol results in increased activity of CASP3 protein |
increases activity
|
protein |
19766705
|
| C423629 | 1312 |
COMT
|
catechol-O-methyltransferase (EC:2.1.1.6) | COMT protein results in increased methylation of 3,4,5,6-tetrachlorocatechol |
increases methylation
|
protein |
11160877
|