| id | C00016145 | 
|---|---|
| Name | Tryprostatin A / (-)-Tryprostatin A / (3S-trans)-Hexahydro-3-[[6-methoxy-2-(3-methyl-2-butenyl)-1H-indol-3-yl]methyl]-pyrrolo[1,2-a]pyrazine-1,4-dione | 
| CAS RN | 171864-80-5 | 
| Standard InChI | InChI=1S/C22H27N3O3/c1-13(2)6-9-17-16(15-8-7-14(28-3)11-18(15)23-17)12-19-22(27)25-10-4-5-20(25)21(26)24-19/h6-8,11,19-20,23H,4-5,9-10,12H2,1-3H3,(H,24,26)/t19?,20-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H27N3O3/c1-13(2)6-9-17-16(15-8-7-14(28-3)11-18(15)23-17)12-19-22(27)25-10-4-5-20(25)21(26)24-19/h6-8,11,19-20,23H,4-5,9-10,12H2,1-3H3,(H,24,26) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2184 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL38718 CHEMBL39220 CHEMBL39517 CHEMBL289159 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Aspergillaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Aspergillus fumigatus | 746128 | Aspergillaceae | Fungi | |
| Isaria tenuipes BCC12625 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL289159 | CHEMBL2075367
                        (1) | 1 / 0 | 
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL38718 | CHEMBL922083
                        (1) | 0 / 0 | 
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL289159 | CHEMBL2075185
                        (1) | 2 / 0 |