| id | C00016150 | 
|---|---|
| Name | TAN 1415A / RES 1214-1 | 
| CAS RN | 577-64-0 | 
| Standard InChI | InChI=1S/C17H16O8/c1-8-4-11(19)14(16(20)21)12(5-8)25-15-10(17(22)24-3)6-9(18)7-13(15)23-2/h4-7,18-19H,1-3H3,(H,20,21) | 
| Standard InChI (Main Layer) | InChI=1S/C17H16O8/c1-8-4-11(19)14(16(20)21)12(5-8)25-15-10(17(22)24-3)6-9(18)7-13(15)23-2/h4-7,18-19H,1-3H3,(H,20,21) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3263 | 
| By standard InChI | CHEMBL469424 | 
|---|---|
| By standard InChI Main Layer | CHEMBL469424 | 
| By LinkDB | 
|---|
| By CAS RN | C078941 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Aspergillaceae | 1 | 
| Amphisphaeriaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Aspergillus sp. | 5065 | Aspergillaceae | Fungi | |
| Pestalotiopsis sp. RE-1214 | 37840 | Amphisphaeriaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL469424 | CHEMBL1614321
                        (1)
                        CHEMBL1614529
                        (1) | 0 / 0 | 
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL469424 | CHEMBL1738312
                        (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL469424 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P14618 | Pyruvate kinase PKM | Enzyme | CHEMBL469424 | CHEMBL1613996
                        (1)
                        CHEMBL1614428
                        (1) | 0 / 0 | 
| P06746 | DNA polymerase beta | Enzyme | CHEMBL469424 | CHEMBL1614079
                        (1) | 0 / 0 | 
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL469424 | CHEMBL1614067
                        (1) | 1 / 2 | 
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL469424 | CHEMBL1614166
                        (1) | 1 / 0 | 
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL469424 | CHEMBL1794311
                        (1) | 2 / 3 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL469424 | CHEMBL1794486
                        (1) | 0 / 0 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL469424 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL469424 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL469424 | CHEMBL2114788
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL469424 | CHEMBL1794569
                        (1) | 1 / 1 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL469424 | CHEMBL1794401
                        (1) | 0 / 0 | 
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL469424 | CHEMBL1614342
                        (1) | 1 / 1 | 
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL469424 | CHEMBL1738588
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL469424 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL469424 | CHEMBL1737991
                        (1) | 0 / 0 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL469424 | CHEMBL1614211
                        (1) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL469424 | CHEMBL1614421
                        (1) | 4 / 3 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL469424 | CHEMBL1738184
                        (1) | 0 / 0 | 
| Q07817 | Bcl-2-like protein 1 | Other cytosolic protein | CHEMBL469424 | CHEMBL1614490
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL469424 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL469424 | CHEMBL1613914
                        (1) | 0 / 0 | 
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL469424 | CHEMBL1613829
                        (1)
                        CHEMBL1794433
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL469424 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL469424 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL469424 | CHEMBL1737904
                        (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL469424 | CHEMBL1737904
                        (1) | 1 / 6 | 
| Q9UBT2 | SUMO-activating enzyme subunit 2 | Enzyme | CHEMBL469424 | CHEMBL1614105
                        (1)
                        CHEMBL1614290
                        (1) | 0 / 0 | 
| Q9UBE0 | SUMO-activating enzyme subunit 1 | Unclassified protein | CHEMBL469424 | CHEMBL1614105
                        (1)
                        CHEMBL1614290
                        (1) | 0 / 0 | 
| P63165 | Small ubiquitin-related modifier 1 | Unclassified protein | CHEMBL469424 | CHEMBL2114737
                        (1)
                        CHEMBL2114825
                        (1) | 1 / 1 | 
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL469424 | CHEMBL2114738
                        (1) | 0 / 0 | 
| Q14191 | Werner syndrome ATP-dependent helicase | Enzyme | CHEMBL469424 | CHEMBL2114796
                        (1) | 2 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #210900 | Bloom syndrome; blm | P54132 | 
| #114500 | Colorectal cancer; crc | P84022 Q14191 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #607948 | Mycobacterium tuberculosis, susceptibility to | P11473 | 
| #160900 | Myotonic dystrophy 1; dm1 | Q9NR56 | 
| #257220 | Niemann-pick disease, type c1; npc1 | O15118 | 
| #613705 | Orofacial cleft 10; ofc10 | P63165 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a | P11473 | 
| #277700 | Werner syndrome; wrn | Q14191 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00136 | Niemann-Pick disease type C (NPC) | O15118
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00342 | Tuberculosis | P11473
                            (related) | 
| H00784 | Localized autosomal recessive hypotrichosis | P11473
                            (related) | 
| H01143 | Vitamin D-dependent rickets | P11473
                            (related) | 
| H00094 | DNA repair defects | P54132
                            (related) | 
| H00296 | Defects in RecQ helicases | P54132
                            (related) Q14191 (related) | 
| H00516 | Isolated orofacial clefts | P63165
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) | 
| H00003 | Acute myeloid leukemia (AML) | Q01196
                            (related) Q01196 (marker) Q13951 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) | 
| H00403 | Disorders of nucleotide excision repair | Q9Y253
                            (related) |