id | C00001699 |
---|---|
Name | Calligonine |
CAS RN | 2254-36-6 |
Standard InChI | InChI=1S/C12H14N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-5,8,13-14H,6-7H2,1H3/t8-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C12H14N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-5,8,13-14H,6-7H2,1H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 2351 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL440524 |
By LinkDB | C09089 |
---|
By CAS RN |
---|
class name | count |
---|---|
rosids | 3 |
eudicotyledons | 1 |
family name | count |
---|---|
Elaeagnaceae | 1 |
Fabaceae | 1 |
Malpighiaceae | 1 |
Polygonaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Banisteriopsis argentea | 151794 | Malpighiaceae | rosids | Viridiplantae |
Calligonum minimum | 467325 | Polygonaceae | eudicotyledons | Viridiplantae |
Elaeagnus angustifolia | 36777 | Elaeagnaceae | rosids | Viridiplantae |
Petalostylis labicheoides | 162878 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P47898 | 5-hydroxytryptamine receptor 5A | Serotonin receptor | CHEMBL440524 |
CHEMBL618086
(1)
|
0 / 0 |