| id | C00016991 |
|---|---|
| Name | Neopetasan / Alloeremophilone / 3-Desoxyneopetasol / Eremophila-9,11-dien-8-one |
| CAS RN | 13902-42-6 |
| Standard InChI | InChI=1S/C15H22O/c1-10(2)13-9-15(4)11(3)6-5-7-12(15)8-14(13)16/h8,11,13H,1,5-7,9H2,2-4H3/t11-,13+,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O/c1-10(2)13-9-15(4)11(3)6-5-7-12(15)8-14(13)16/h8,11,13H,1,5-7,9H2,2-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 543 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| Scrophulariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eremophila mitchelli | 4149 | Scrophulariaceae | asterids | Viridiplantae |
| Petasites hybridus | 278673 | Asteraceae | asterids | Viridiplantae |