id | C00017063 |
---|---|
Name | Exfoliazone / Antibiotic BT 38 |
CAS RN | 132627-73-7 |
Standard InChI | InChI=1S/C15H12N2O4/c1-8(19)16-10-5-12-15(6-13(10)20)21-14-3-2-9(7-18)4-11(14)17-12/h2-6,18H,7H2,1H3,(H,16,19) |
Standard InChI (Main Layer) | InChI=1S/C15H12N2O4/c1-8(19)16-10-5-12-15(6-13(10)20)21-14-3-2-9(7-18)4-11(14)17-12/h2-6,18H,7H2,1H3,(H,16,19) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1379 |
By standard InChI | CHEMBL2311997 |
---|---|
By standard InChI Main Layer | CHEMBL2311997 |
By LinkDB |
---|
By CAS RN | C067081 |
---|
class name | count |
---|
family name | count |
---|---|
Streptomycetaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Streptomyces exfoliatus BT-38 | 1883 | Streptomycetaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL2311997 |
CHEMBL2330523
(1)
CHEMBL2330524
(1)
CHEMBL2330525 (1) |
0 / 0 |