| id | C00017075 |
|---|---|
| Name | Reveromycin A |
| CAS RN | 134615-37-5 |
| Standard InChI | InChI=1S/C36H52O11/c1-6-7-19-35(47-34(44)17-16-32(40)41)21-22-36(46-30(35)14-10-25(3)23-33(42)43)20-18-27(5)29(45-36)13-9-24(2)8-12-28(37)26(4)11-15-31(38)39/h8-12,14-15,23,26-30,37H,6-7,13,16-22H2,1-5H3,(H,38,39)(H,40,41)(H,42,43)/b12-8+,14-10+,15-11+,24-9+,25-23+/t26-,27-,28-,29+,30-,35+,36-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H52O11/c1-6-7-19-35(47-34(44)17-16-32(40)41)21-22-36(46-30(35)14-10-25(3)23-33(42)43)20-18-27(5)29(45-36)13-9-24(2)8-12-28(37)26(4)11-15-31(38)39/h8-12,14-15,23,26-30,37H,6-7,13,16-22H2,1-5H3,(H,38,39)(H,40,41)(H,42,43) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3078 |
| By standard InChI | CHEMBL332724 |
|---|---|
| By standard InChI Main Layer | CHEMBL332724 CHEMBL443981 |
| By LinkDB |
|---|
| By CAS RN | C068098 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. | 1931 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41252 | Isoleucine--tRNA ligase, cytoplasmic | Enzyme | CHEMBL332724 CHEMBL443981 |
CHEMBL953960
(2)
|
0 / 0 |